C32H43N3O7 — CID 118362904
methyl (E)-3-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]phenyl]prop-2-enoate (PubChem CID 118362904) has the molecular formula C32H43N3O7 and a molecular weight of 581.71 g/mol. Its IUPAC name is methyl (E)-3-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 118362904 |
| Molecular Formula | C32H43N3O7 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | methyl (E)-3-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CCCC(=O)Nc2ccc(CCN(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H43N3O7/c1-31(2,3)41-29(38)34-35(30(39)42-32(4,5)6)22-21-25-15-18-26(19-16-25)33-27(36)10-8-9-23-11-13-24(14-12-23)17-20-28(37)40-7/h11-20H,8-10,21-22H2,1-7H3,(H,33,36)(H,34,38)/b20-17+ |
| InChIKey | LNCQZACWMXZPQM-LVZFUZTISA-N |
| XLogP | 6.05 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|