C25H31N3O4 — CID 108920713
tert-butyl N-[3-[4-[[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]methyl]anilino]-3-oxopropyl]carbamate (PubChem CID 108920713) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]methyl]anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]methyl]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108920713 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl N-[3-[4-[[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]methyl]anilino]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(/C=C/C(=O)NCc2ccc(NC(=O)CCNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-18-5-7-19(8-6-18)11-14-22(29)27-17-20-9-12-21(13-10-20)28-23(30)15-16-26-24(31)32-25(2,3)4/h5-14H,15-17H2,1-4H3,(H,26,31)(H,27,29)(H,28,30)/b14-11+ |
| InChIKey | OOZDWLVZZGTIJC-SDNWHVSQSA-N |
| XLogP | 4.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|