C26H39N3O7 — CID 123588353
methyl 4-[4-[(6-anilino-6-oxohexyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-hydroxyamino]-4-oxobut-2-enoate (PubChem CID 123588353) has the molecular formula C26H39N3O7 and a molecular weight of 505.61 g/mol. Its IUPAC name is methyl 4-[4-[(6-anilino-6-oxohexyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-hydroxyamino]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[4-[(6-anilino-6-oxohexyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-hydroxyamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 123588353 |
| Molecular Formula | C26H39N3O7 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | methyl 4-[4-[(6-anilino-6-oxohexyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl-hydroxyamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)C=CC(=O)N(O)CCCCN(CCCCCC(=O)Nc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H39N3O7/c1-26(2,3)36-25(33)28(19-11-12-20-29(34)23(31)16-17-24(32)35-4)18-10-6-9-15-22(30)27-21-13-7-5-8-14-21/h5,7-8,13-14,16-17,34H,6,9-12,15,18-20H2,1-4H3,(H,27,30) |
| InChIKey | OFQFQGYTWNNWIE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|