C28H35N3O3 — CID 58982171
tert-butyl N-[6-(2-aminoanilino)-6-oxohexyl]-N-(naphthalen-2-ylmethyl)carbamate (PubChem CID 58982171) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl N-[6-(2-aminoanilino)-6-oxohexyl]-N-(naphthalen-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[6-(2-aminoanilino)-6-oxohexyl]-N-(naphthalen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 58982171 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl N-[6-(2-aminoanilino)-6-oxohexyl]-N-(naphthalen-2-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCC(=O)Nc1ccccc1N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H35N3O3/c1-28(2,3)34-27(33)31(20-21-16-17-22-11-6-7-12-23(22)19-21)18-10-4-5-15-26(32)30-25-14-9-8-13-24(25)29/h6-9,11-14,16-17,19H,4-5,10,15,18,20,29H2,1-3H3,(H,30,32) |
| InChIKey | WUWMDLKCLCHMSP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|