C30H36N2O6 — CID 170334370
6-[(2-methylpropan-2-yl)oxycarbonyl-(naphthalen-2-ylmethyl)amino]-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 170334370) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxycarbonyl-(naphthalen-2-ylmethyl)amino]-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 6-[(2-methylpropan-2-yl)oxycarbonyl-(naphthalen-2-ylmethyl)amino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 170334370 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxycarbonyl-(naphthalen-2-ylmethyl)amino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCC(NC(=O)OCc1ccccc1)C(=O)O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H36N2O6/c1-30(2,3)38-29(36)32(20-23-16-17-24-13-7-8-14-25(24)19-23)18-10-9-15-26(27(33)34)31-28(35)37-21-22-11-5-4-6-12-22/h4-8,11-14,16-17,19,26H,9-10,15,18,20-21H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | XLXXLJGPKZBSJI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|