C32H40N4O3 — CID 155517418
N-[6-(2-aminoanilino)-6-oxohexyl]-N-[2-[(3,5-dimethylphenyl)methylamino]-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 155517418) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-N-[2-[(3,5-dimethylphenyl)methylamino]-2-oxoethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-N-[2-[(3,5-dimethylphenyl)methylamino]-2-oxoethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 155517418 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-N-[2-[(3,5-dimethylphenyl)methylamino]-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(CNC(=O)CN(CCCCCC(=O)Nc2ccccc2N)C(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C32H40N4O3/c1-22-14-23(2)17-26(16-22)20-34-31(38)21-36(32(39)27-18-24(3)15-25(4)19-27)13-9-5-6-12-30(37)35-29-11-8-7-10-28(29)33/h7-8,10-11,14-19H,5-6,9,12-13,20-21,33H2,1-4H3,(H,34,38)(H,35,37) |
| InChIKey | YEJPAUXCGZXHNF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|