C32H43N5O2 — CID 24883370
N-(2-aminophenyl)-4-[[6-[4-[(4-methylphenyl)methylamino]butylamino]hexanoylamino]methyl]benzamide (PubChem CID 24883370) has the molecular formula C32H43N5O2 and a molecular weight of 529.73 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[6-[4-[(4-methylphenyl)methylamino]butylamino]hexanoylamino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[6-[4-[(4-methylphenyl)methylamino]butylamino]hexanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 24883370 |
| Molecular Formula | C32H43N5O2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | N-(2-aminophenyl)-4-[[6-[4-[(4-methylphenyl)methylamino]butylamino]hexanoylamino]methyl]benzamide |
| SMILES | Cc1ccc(CNCCCCNCCCCCC(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C32H43N5O2/c1-25-12-14-26(15-13-25)23-35-22-8-7-21-34-20-6-2-3-11-31(38)36-24-27-16-18-28(19-17-27)32(39)37-30-10-5-4-9-29(30)33/h4-5,9-10,12-19,34-35H,2-3,6-8,11,20-24,33H2,1H3,(H,36,38)(H,37,39) |
| InChIKey | NRSDSNGUEPJHAF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|