C31H29N3O2S — CID 25265023
N-(2-aminophenyl)-4-[[[(E)-2-(4-methylphenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]methyl]benzamide (PubChem CID 25265023) has the molecular formula C31H29N3O2S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[(E)-2-(4-methylphenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[(E)-2-(4-methylphenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 25265023 |
| Molecular Formula | C31H29N3O2S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[(E)-2-(4-methylphenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]methyl]benzamide |
| SMILES | CSc1ccc(/C=C(/C(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H29N3O2S/c1-21-7-13-24(14-8-21)27(19-22-11-17-26(37-2)18-12-22)31(36)33-20-23-9-15-25(16-10-23)30(35)34-29-6-4-3-5-28(29)32/h3-19H,20,32H2,1-2H3,(H,33,36)(H,34,35)/b27-19+ |
| InChIKey | MNQWCPVBUVYTHK-ZXVVBBHZSA-N |
| XLogP | 6.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|