C31H26FN3O4 — CID 25265171
methyl 4-[(E)-3-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-2-(2-fluorophenyl)-3-oxoprop-1-enyl]benzoate (PubChem CID 25265171) has the molecular formula C31H26FN3O4 and a molecular weight of 523.56 g/mol. Its IUPAC name is methyl 4-[(E)-3-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-2-(2-fluorophenyl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-2-(2-fluorophenyl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 25265171 |
| Molecular Formula | C31H26FN3O4 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | methyl 4-[(E)-3-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-2-(2-fluorophenyl)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(/C(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C31H26FN3O4/c1-39-31(38)23-16-10-20(11-17-23)18-25(24-6-2-3-7-26(24)32)30(37)34-19-21-12-14-22(15-13-21)29(36)35-28-9-5-4-8-27(28)33/h2-18H,19,33H2,1H3,(H,34,37)(H,35,36)/b25-18+ |
| InChIKey | VTDYHPDBZLUHAW-XIEYBQDHSA-N |
| XLogP | 5.30 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|