C25H22ClN3O2 — CID 68769130
N-(2-aminophenyl)-4-[(Z)-2-(2-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 68769130) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(Z)-2-(2-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(Z)-2-(2-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 68769130 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-(2-aminophenyl)-4-[(Z)-2-(2-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(/C=C(\C(=O)NC2CC2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H22ClN3O2/c26-21-6-2-1-5-19(21)20(25(31)28-18-13-14-18)15-16-9-11-17(12-10-16)24(30)29-23-8-4-3-7-22(23)27/h1-12,15,18H,13-14,27H2,(H,28,31)(H,29,30)/b20-15- |
| InChIKey | NUZKATLWHLQXRH-HKWRFOASSA-N |
| XLogP | 4.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|