C25H24FN3O — CID 59575560
N-(2-aminophenyl)-4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)prop-1-enyl]benzamide (PubChem CID 59575560) has the molecular formula C25H24FN3O and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)prop-1-enyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 59575560 |
| Molecular Formula | C25H24FN3O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)prop-1-enyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(/C=C(/CNC2CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H24FN3O/c26-21-11-9-18(10-12-21)20(16-28-22-13-14-22)15-17-5-7-19(8-6-17)25(30)29-24-4-2-1-3-23(24)27/h1-12,15,22,28H,13-14,16,27H2,(H,29,30)/b20-15- |
| InChIKey | UECNKHYAJZBALW-HKWRFOASSA-N |
| XLogP | 4.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|