C29H26FN3O2 — CID 143788196
N-(2-aminophenyl)-4-methylbenzamide;(E)-3-(4-fluorophenyl)-2-phenylprop-2-enamide (PubChem CID 143788196) has the molecular formula C29H26FN3O2 and a molecular weight of 467.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-methylbenzamide;(E)-3-(4-fluorophenyl)-2-phenylprop-2-enamide.
| Compound Name | N-(2-aminophenyl)-4-methylbenzamide;(E)-3-(4-fluorophenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 143788196 |
| Molecular Formula | C29H26FN3O2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-(2-aminophenyl)-4-methylbenzamide;(E)-3-(4-fluorophenyl)-2-phenylprop-2-enamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2N)cc1.NC(=O)/C(=C/c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H12FNO.C14H14N2O/c16-13-8-6-11(7-9-13)10-14(15(17)18)12-4-2-1-3-5-12;1-10-6-8-11(9-7-10)14(17)16-13-5-3-2-4-12(13)15/h1-10H,(H2,17,18);2-9H,15H2,1H3,(H,16,17)/b14-10+; |
| InChIKey | PHBSPJBMHYAXLU-KMZJGFRYSA-N |
| XLogP | 5.68 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|