C30H28FN3O3 — CID 143788229
N-(2-aminophenyl)-4-methylbenzamide;(E)-2-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 143788229) has the molecular formula C30H28FN3O3 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-methylbenzamide;(E)-2-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-4-methylbenzamide;(E)-2-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 143788229 |
| Molecular Formula | C30H28FN3O3 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-(2-aminophenyl)-4-methylbenzamide;(E)-2-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(N)=O)c2ccc(F)cc2)cc1.Cc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C16H14FNO2.C14H14N2O/c1-20-14-8-2-11(3-9-14)10-15(16(18)19)12-4-6-13(17)7-5-12;1-10-6-8-11(9-7-10)14(17)16-13-5-3-2-4-12(13)15/h2-10H,1H3,(H2,18,19);2-9H,15H2,1H3,(H,16,17)/b15-10+; |
| InChIKey | GVCFFCVVDKUOEZ-GYVLLFFHSA-N |
| XLogP | 5.69 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|