C30H25FN4O4 — CID 59475036
N-(2-aminophenyl)-4-[[[(E)-3-(4-fluoro-3-methylphenyl)-2-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide (PubChem CID 59475036) has the molecular formula C30H25FN4O4 and a molecular weight of 524.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[(E)-3-(4-fluoro-3-methylphenyl)-2-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[(E)-3-(4-fluoro-3-methylphenyl)-2-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 59475036 |
| Molecular Formula | C30H25FN4O4 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[(E)-3-(4-fluoro-3-methylphenyl)-2-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide |
| SMILES | Cc1cc(/C=C(/C(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)c2ccc([N+](=O)[O-])cc2)ccc1F |
| InChI | InChI=1S/C30H25FN4O4/c1-19-16-21(8-15-26(19)31)17-25(22-11-13-24(14-12-22)35(38)39)30(37)33-18-20-6-9-23(10-7-20)29(36)34-28-5-3-2-4-27(28)32/h2-17H,18,32H2,1H3,(H,33,37)(H,34,36)/b25-17+ |
| InChIKey | PUUPMRBDTZNXCV-KOEQRZSOSA-N |
| XLogP | 5.73 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|