C28H33N5O4 — CID 58001300
methyl 4-[[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl-[3-(dimethylamino)propyl]carbamoyl]amino]benzoate (PubChem CID 58001300) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is methyl 4-[[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl-[3-(dimethylamino)propyl]carbamoyl]amino]benzoate.
| Compound Name | methyl 4-[[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl-[3-(dimethylamino)propyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 58001300 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | methyl 4-[[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl-[3-(dimethylamino)propyl]carbamoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N(CCCN(C)C)Cc2ccc(C(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C28H33N5O4/c1-32(2)17-6-18-33(28(36)30-23-15-13-22(14-16-23)27(35)37-3)19-20-9-11-21(12-10-20)26(34)31-25-8-5-4-7-24(25)29/h4-5,7-16H,6,17-19,29H2,1-3H3,(H,30,36)(H,31,34) |
| InChIKey | UNEHTGGNBPZDQA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|