C27H30N4O3 — CID 58000994
N-(2-aminophenyl)-4-[[2,3-dihydro-1H-inden-5-ylcarbamoyl(3-hydroxypropyl)amino]methyl]benzamide (PubChem CID 58000994) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[2,3-dihydro-1H-inden-5-ylcarbamoyl(3-hydroxypropyl)amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[2,3-dihydro-1H-inden-5-ylcarbamoyl(3-hydroxypropyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 58000994 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[[2,3-dihydro-1H-inden-5-ylcarbamoyl(3-hydroxypropyl)amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN(CCCO)C(=O)Nc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C27H30N4O3/c28-24-7-1-2-8-25(24)30-26(33)21-11-9-19(10-12-21)18-31(15-4-16-32)27(34)29-23-14-13-20-5-3-6-22(20)17-23/h1-2,7-14,17,32H,3-6,15-16,18,28H2,(H,29,34)(H,30,33) |
| InChIKey | UJXBLLUJYSRCOR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|