C25H26N4O5 — CID 58001118
N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylcarbamoyl(2-methoxyethyl)amino]methyl]benzamide (PubChem CID 58001118) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylcarbamoyl(2-methoxyethyl)amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylcarbamoyl(2-methoxyethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 58001118 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylcarbamoyl(2-methoxyethyl)amino]methyl]benzamide |
| SMILES | COCCN(Cc1ccc(C(=O)Nc2ccccc2N)cc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H26N4O5/c1-32-13-12-29(25(31)27-19-10-11-22-23(14-19)34-16-33-22)15-17-6-8-18(9-7-17)24(30)28-21-5-3-2-4-20(21)26/h2-11,14H,12-13,15-16,26H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | ITSQRHOBNROLCB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|