C34H35N2O7+ — CID 163714222
[(2S)-3-[4-[3-[1,3-benzodioxol-5-ylcarbamoyl(benzyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoyl]oxidanium (PubChem CID 163714222) has the molecular formula C34H35N2O7+ and a molecular weight of 583.66 g/mol. Its IUPAC name is [(2S)-3-[4-[3-[1,3-benzodioxol-5-ylcarbamoyl(benzyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoyl]oxidanium.
| Compound Name | [(2S)-3-[4-[3-[1,3-benzodioxol-5-ylcarbamoyl(benzyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoyl]oxidanium |
|---|---|
| PubChem CID | 163714222 |
| Molecular Formula | C34H35N2O7+ |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | [(2S)-3-[4-[3-[1,3-benzodioxol-5-ylcarbamoyl(benzyl)amino]propoxy]phenyl]-2-methyl-2-phenoxypropanoyl]oxidanium |
| SMILES | C[C@@](Cc1ccc(OCCCN(Cc2ccccc2)C(=O)Nc2ccc3c(c2)OCO3)cc1)(Oc1ccccc1)C(=O)[OH2+] |
| InChI | InChI=1S/C34H34N2O7/c1-34(32(37)38,43-29-11-6-3-7-12-29)22-25-13-16-28(17-14-25)40-20-8-19-36(23-26-9-4-2-5-10-26)33(39)35-27-15-18-30-31(21-27)42-24-41-30/h2-7,9-18,21H,8,19-20,22-24H2,1H3,(H,35,39)(H,37,38)/p+1/t34-/m0/s1 |
| InChIKey | KLXVVHJGWOHQPI-UMSFTDKQSA-O |
| XLogP | 5.55 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|