C36H40N2O5 — CID 70997911
methyl 3-[4-[3-[benzyl-[(4-phenylphenyl)carbamoyl]amino]propoxy]phenyl]-2-ethoxy-2-methylpropanoate (PubChem CID 70997911) has the molecular formula C36H40N2O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is methyl 3-[4-[3-[benzyl-[(4-phenylphenyl)carbamoyl]amino]propoxy]phenyl]-2-ethoxy-2-methylpropanoate.
| Compound Name | methyl 3-[4-[3-[benzyl-[(4-phenylphenyl)carbamoyl]amino]propoxy]phenyl]-2-ethoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 70997911 |
| Molecular Formula | C36H40N2O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | methyl 3-[4-[3-[benzyl-[(4-phenylphenyl)carbamoyl]amino]propoxy]phenyl]-2-ethoxy-2-methylpropanoate |
| SMILES | CCOC(C)(Cc1ccc(OCCCN(Cc2ccccc2)C(=O)Nc2ccc(-c3ccccc3)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C36H40N2O5/c1-4-43-36(2,34(39)41-3)26-28-16-22-33(23-17-28)42-25-11-24-38(27-29-12-7-5-8-13-29)35(40)37-32-20-18-31(19-21-32)30-14-9-6-10-15-30/h5-10,12-23H,4,11,24-27H2,1-3H3,(H,37,40) |
| InChIKey | LNDIQJLZOGONEA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|