C28H33N5O3 — CID 140544490
N-[4-[[(4-acetylphenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]-2-aminophenyl]benzamide (PubChem CID 140544490) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[4-[[(4-acetylphenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]-2-aminophenyl]benzamide.
| Compound Name | N-[4-[[(4-acetylphenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]-2-aminophenyl]benzamide |
|---|---|
| PubChem CID | 140544490 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-[4-[[(4-acetylphenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]-2-aminophenyl]benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)N(CCCN(C)C)Cc2ccc(NC(=O)c3ccccc3)c(N)c2)cc1 |
| InChI | InChI=1S/C28H33N5O3/c1-20(34)22-11-13-24(14-12-22)30-28(36)33(17-7-16-32(2)3)19-21-10-15-26(25(29)18-21)31-27(35)23-8-5-4-6-9-23/h4-6,8-15,18H,7,16-17,19,29H2,1-3H3,(H,30,36)(H,31,35) |
| InChIKey | KOZAXAXNNRADFL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|