C26H24N6O4 — CID 162656980
N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 162656980) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162656980 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1C(=O)Nc1cn[nH]c1C(=O)NCc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C26H24N6O4/c1-36-22-9-5-2-6-18(22)25(34)31-21-15-29-32-23(21)26(35)28-14-16-10-12-17(13-11-16)24(33)30-20-8-4-3-7-19(20)27/h2-13,15H,14,27H2,1H3,(H,28,35)(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | ALYQPHNACFSEKS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|