C20H19N5O5 — CID 162647906
N-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 162647906) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162647906 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-4-[(2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1C(=O)Nc1cn[nH]c1C(=O)NCc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C20H19N5O5/c1-30-16-5-3-2-4-14(16)19(27)23-15-11-22-24-17(15)20(28)21-10-12-6-8-13(9-7-12)18(26)25-29/h2-9,11,29H,10H2,1H3,(H,21,28)(H,22,24)(H,23,27)(H,25,26) |
| InChIKey | UFJRPDHNYZLSRH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|