C18H24N4O4 — CID 118714297
4-[(2,6-dimethoxybenzoyl)amino]-N-pentyl-1H-pyrazole-5-carboxamide (PubChem CID 118714297) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[(2,6-dimethoxybenzoyl)amino]-N-pentyl-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(2,6-dimethoxybenzoyl)amino]-N-pentyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118714297 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-[(2,6-dimethoxybenzoyl)amino]-N-pentyl-1H-pyrazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1[nH]ncc1NC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C18H24N4O4/c1-4-5-6-10-19-18(24)16-12(11-20-22-16)21-17(23)15-13(25-2)8-7-9-14(15)26-3/h7-9,11H,4-6,10H2,1-3H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | NBQJSDZRPFLUGK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|