C20H27FN4O5 — CID 160503573
4-[(2-fluoro-6-methoxybenzoyl)amino]-N-[4-(methoxymethoxy)cyclohexyl]-1H-pyrazole-5-carboxamide;molecular hydrogen (PubChem CID 160503573) has the molecular formula C20H27FN4O5 and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-[(2-fluoro-6-methoxybenzoyl)amino]-N-[4-(methoxymethoxy)cyclohexyl]-1H-pyrazole-5-carboxamide;molecular hydrogen.
| Compound Name | 4-[(2-fluoro-6-methoxybenzoyl)amino]-N-[4-(methoxymethoxy)cyclohexyl]-1H-pyrazole-5-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 160503573 |
| Molecular Formula | C20H27FN4O5 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-[(2-fluoro-6-methoxybenzoyl)amino]-N-[4-(methoxymethoxy)cyclohexyl]-1H-pyrazole-5-carboxamide;molecular hydrogen |
| SMILES | COCOC1CCC(NC(=O)c2[nH]ncc2NC(=O)c2c(F)cccc2OC)CC1.[H][H] |
| InChI | InChI=1S/C20H25FN4O5.H2/c1-28-11-30-13-8-6-12(7-9-13)23-20(27)18-15(10-22-25-18)24-19(26)17-14(21)4-3-5-16(17)29-2;/h3-5,10,12-13H,6-9,11H2,1-2H3,(H,22,25)(H,23,27)(H,24,26);1H |
| InChIKey | QSCKQDBJVHBLLK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|