C22H25N5O3 — CID 67105958
N-(2-aminophenyl)-4-[(5-tert-butyl-2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 67105958) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(5-tert-butyl-2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-aminophenyl)-4-[(5-tert-butyl-2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 67105958 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[(5-tert-butyl-2-methoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(C(C)(C)C)cc1C(=O)Nc1cn[nH]c1C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C22H25N5O3/c1-22(2,3)13-9-10-18(30-4)14(11-13)20(28)26-17-12-24-27-19(17)21(29)25-16-8-6-5-7-15(16)23/h5-12H,23H2,1-4H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | ZZSPVYIKOPOOAT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|