C13H15N5O3 — CID 63101953
N-(5-acetamido-2-methoxyphenyl)-4-amino-1H-pyrazole-5-carboxamide (PubChem CID 63101953) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-4-amino-1H-pyrazole-5-carboxamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-4-amino-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63101953 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-4-amino-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)c1[nH]ncc1N |
| InChI | InChI=1S/C13H15N5O3/c1-7(19)16-8-3-4-11(21-2)10(5-8)17-13(20)12-9(14)6-15-18-12/h3-6H,14H2,1-2H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | YBQHNEXMMLCFJW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |