C13H15N3O3 — CID 110860648
N-(3,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxamide (PubChem CID 110860648) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 110860648 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2[nH]ncc2C)cc1OC |
| InChI | InChI=1S/C13H15N3O3/c1-8-7-14-16-12(8)13(17)15-9-4-5-10(18-2)11(6-9)19-3/h4-7H,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | XUZGNLYDHMKFJQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |