C13H14N2O4 — CID 110702289
N-(3,4-dimethoxyphenyl)-2-methyl-1,3-oxazole-5-carboxamide (PubChem CID 110702289) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110702289 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-methyl-1,3-oxazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc(C)o2)cc1OC |
| InChI | InChI=1S/C13H14N2O4/c1-8-14-7-12(19-8)13(16)15-9-4-5-10(17-2)11(6-9)18-3/h4-7H,1-3H3,(H,15,16) |
| InChIKey | CEZIFFPYXOVRND-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |