C12H10N4O — CID 110864874
N-(4-cyanophenyl)-4-methyl-1H-pyrazole-5-carboxamide (PubChem CID 110864874) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(4-cyanophenyl)-4-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 110864874 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(4-cyanophenyl)-4-methyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cn[nH]c1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H10N4O/c1-8-7-14-16-11(8)12(17)15-10-4-2-9(6-13)3-5-10/h2-5,7H,1H3,(H,14,16)(H,15,17) |
| InChIKey | OSMMDAWUSCDERM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |