C16H11N5O2 — CID 108519482
N-(4-cyanophenyl)-N'-(1H-indazol-6-yl)oxamide (PubChem CID 108519482) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-(1H-indazol-6-yl)oxamide.
| Compound Name | N-(4-cyanophenyl)-N'-(1H-indazol-6-yl)oxamide |
|---|---|
| PubChem CID | 108519482 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(4-cyanophenyl)-N'-(1H-indazol-6-yl)oxamide |
| SMILES | N#Cc1ccc(NC(=O)C(=O)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C16H11N5O2/c17-8-10-1-4-12(5-2-10)19-15(22)16(23)20-13-6-3-11-9-18-21-14(11)7-13/h1-7,9H,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | ORENKRRLBXDENW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|