C19H21N5O2 — CID 108530092
N-[4-(diethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide (PubChem CID 108530092) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide |
|---|---|
| PubChem CID | 108530092 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-24(4-2)16-9-7-14(8-10-16)21-18(25)19(26)22-15-6-5-13-12-20-23-17(13)11-15/h5-12H,3-4H2,1-2H3,(H,20,23)(H,21,25)(H,22,26) |
| InChIKey | QXWLASIDBLSSSB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|