C20H23N5O2 — CID 108530134
N'-[4-(diethylamino)-2-methylphenyl]-N-(1H-indazol-6-yl)oxamide (PubChem CID 108530134) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N'-[4-(diethylamino)-2-methylphenyl]-N-(1H-indazol-6-yl)oxamide.
| Compound Name | N'-[4-(diethylamino)-2-methylphenyl]-N-(1H-indazol-6-yl)oxamide |
|---|---|
| PubChem CID | 108530134 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N'-[4-(diethylamino)-2-methylphenyl]-N-(1H-indazol-6-yl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nc2ccc3cn[nH]c3c2)c(C)c1 |
| InChI | InChI=1S/C20H23N5O2/c1-4-25(5-2)16-8-9-17(13(3)10-16)23-20(27)19(26)22-15-7-6-14-12-21-24-18(14)11-15/h6-12H,4-5H2,1-3H3,(H,21,24)(H,22,26)(H,23,27) |
| InChIKey | DPMIWNVFGZRBQX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|