C11H9F3N4O2 — CID 63101769
4-amino-N-[4-(difluoromethoxy)-3-fluorophenyl]-1H-pyrazole-5-carboxamide (PubChem CID 63101769) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 4-amino-N-[4-(difluoromethoxy)-3-fluorophenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-[4-(difluoromethoxy)-3-fluorophenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63101769 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-amino-N-[4-(difluoromethoxy)-3-fluorophenyl]-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cn[nH]c1C(=O)Nc1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C11H9F3N4O2/c12-6-3-5(1-2-8(6)20-11(13)14)17-10(19)9-7(15)4-16-18-9/h1-4,11H,15H2,(H,16,18)(H,17,19) |
| InChIKey | CCLLLKXDCHXBDX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |