C11H12N4OS — CID 63105759
4-amino-N-(3-methylsulfanylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 63105759) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-amino-N-(3-methylsulfanylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(3-methylsulfanylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63105759 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 4-amino-N-(3-methylsulfanylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CSc1cccc(NC(=O)c2[nH]ncc2N)c1 |
| InChI | InChI=1S/C11H12N4OS/c1-17-8-4-2-3-7(5-8)14-11(16)10-9(12)6-13-15-10/h2-6H,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | VZIDKUCYTVBGGN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |