C44H58N6O3 — CID 24854436
N'-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]octanediamide (PubChem CID 24854436) has the molecular formula C44H58N6O3 and a molecular weight of 718.99 g/mol. Its IUPAC name is N'-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]octanediamide.
| Compound Name | N'-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]octanediamide |
|---|---|
| PubChem CID | 24854436 |
| Molecular Formula | C44H58N6O3 |
| Molecular Weight | 718.99 g/mol |
| Exact Mass | 718.46 |
| IUPAC Name | N'-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)CCCCCCC(=O)NCCCNCCCCNCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H58N6O3/c45-40-20-11-12-21-41(40)50-44(53)38-26-24-35(25-27-38)34-49-43(52)23-10-2-1-9-22-42(51)48-32-15-31-46-29-13-14-30-47-33-28-39(36-16-5-3-6-17-36)37-18-7-4-8-19-37/h3-8,11-12,16-21,24-27,39,46-47H,1-2,9-10,13-15,22-23,28-34,45H2,(H,48,51)(H,49,52)(H,50,53) |
| InChIKey | FMLDOEOHIHOBGM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 137.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.99 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|