C36H55N3O4 — CID 46221208
tert-butyl N-[(3,5-ditert-butylphenyl)methyl]-N-[5-[[3-(3,5-dimethylanilino)-3-oxopropyl]amino]-5-oxopentyl]carbamate (PubChem CID 46221208) has the molecular formula C36H55N3O4 and a molecular weight of 593.85 g/mol. Its IUPAC name is tert-butyl N-[(3,5-ditert-butylphenyl)methyl]-N-[5-[[3-(3,5-dimethylanilino)-3-oxopropyl]amino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(3,5-ditert-butylphenyl)methyl]-N-[5-[[3-(3,5-dimethylanilino)-3-oxopropyl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 46221208 |
| Molecular Formula | C36H55N3O4 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.42 |
| IUPAC Name | tert-butyl N-[(3,5-ditert-butylphenyl)methyl]-N-[5-[[3-(3,5-dimethylanilino)-3-oxopropyl]amino]-5-oxopentyl]carbamate |
| SMILES | Cc1cc(C)cc(NC(=O)CCNC(=O)CCCCN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C36H55N3O4/c1-25-18-26(2)20-30(19-25)38-32(41)15-16-37-31(40)14-12-13-17-39(33(42)43-36(9,10)11)24-27-21-28(34(3,4)5)23-29(22-27)35(6,7)8/h18-23H,12-17,24H2,1-11H3,(H,37,40)(H,38,41) |
| InChIKey | PKYOXLYNVYKYSF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|