C21H25Cl2FN4O3 — CID 130474678
tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl]-N-[(3,5-dichlorophenyl)methyl]carbamate (PubChem CID 130474678) has the molecular formula C21H25Cl2FN4O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl]-N-[(3,5-dichlorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl]-N-[(3,5-dichlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 130474678 |
| Molecular Formula | C21H25Cl2FN4O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl]-N-[(3,5-dichlorophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCC(=O)Nc1ccc(F)nc1N)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2FN4O3/c1-21(2,3)31-20(30)28(12-13-9-14(22)11-15(23)10-13)8-4-5-18(29)26-16-6-7-17(24)27-19(16)25/h6-7,9-11H,4-5,8,12H2,1-3H3,(H2,25,27)(H,26,29) |
| InChIKey | MWOHLNRCUVICNL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|