About tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate
tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate (PubChem CID 58531470) has the molecular formula C22H36ClNO2
and a molecular weight of 381.99 g/mol. Its IUPAC name is tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate |
| PubChem CID | 58531470 |
| Molecular Formula | C22H36ClNO2 |
| Molecular Weight | 381.99 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CCCc1cc(Cl)cc(CN(CC(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H36ClNO2/c1-16(2)9-8-10-18-11-19(13-20(23)12-18)15-24(14-17(3)4)21(25)26-22(5,6)7/h11-13,16-17H,8-10,14-15H2,1-7H3 |
| InChIKey | WLYLPTQCHBRWAP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.99 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate?
The IUPAC name of tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate (CID 58531470) is tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate.
What is the SMILES notation for tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate?
The canonical SMILES for tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate is CC(C)CCCc1cc(Cl)cc(CN(CC(C)C)C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate?
The InChIKey is WLYLPTQCHBRWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36ClNO2/c1-16(2)9-8-10-18-11-19(13-20(23)12-18)15-24(14-17(3)4)21(25)26-22(5,6)7/h11-13,16-17H,8-10,14-15H2,1-7H3.
What are the key properties of tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate?
tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate has a molecular weight of 381.99 g/mol, XLogP of 6.71, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[3-chloro-5-(4-methylpentyl)phenyl]methyl]-N-(2-methylpropyl)carbamate is sourced from PubChem (CID 58531470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).