C20H33NO5 — CID 131737053
tert-butyl N-[3-[3,5-bis(hydroxymethyl)phenoxy]propyl]-N-(2-methylpropyl)carbamate (PubChem CID 131737053) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[3-[3,5-bis(hydroxymethyl)phenoxy]propyl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[3-[3,5-bis(hydroxymethyl)phenoxy]propyl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 131737053 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | tert-butyl N-[3-[3,5-bis(hydroxymethyl)phenoxy]propyl]-N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CN(CCCOc1cc(CO)cc(CO)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO5/c1-15(2)12-21(19(24)26-20(3,4)5)7-6-8-25-18-10-16(13-22)9-17(11-18)14-23/h9-11,15,22-23H,6-8,12-14H2,1-5H3 |
| InChIKey | UZHKBLGBLRVRFJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|