C20H28ClF2NO5 — CID 126673446
tert-butyl N-[3-[4-(chloromethyl)-3,5-difluorophenoxy]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 126673446) has the molecular formula C20H28ClF2NO5 and a molecular weight of 435.90 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(chloromethyl)-3,5-difluorophenoxy]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(chloromethyl)-3,5-difluorophenoxy]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 126673446 |
| Molecular Formula | C20H28ClF2NO5 |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | tert-butyl N-[3-[4-(chloromethyl)-3,5-difluorophenoxy]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCOc1cc(F)c(CCl)c(F)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28ClF2NO5/c1-19(2,3)28-17(25)24(18(26)29-20(4,5)6)8-7-9-27-13-10-15(22)14(12-21)16(23)11-13/h10-11H,7-9,12H2,1-6H3 |
| InChIKey | HNTXXVOCPLGVAK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|