C22H33ClN2O9 — CID 171765962
tert-butyl N-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 171765962) has the molecular formula C22H33ClN2O9 and a molecular weight of 504.96 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 171765962 |
| Molecular Formula | C22H33ClN2O9 |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOc1cc(Cl)cc([N+](=O)[O-])c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33ClN2O9/c1-21(2,3)33-19(26)24(20(27)34-22(4,5)6)7-8-30-9-10-31-11-12-32-18-14-16(23)13-17(15-18)25(28)29/h13-15H,7-12H2,1-6H3 |
| InChIKey | MAONUNHGQOEKRY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|