C31H44ClNO12 — CID 171765955
tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 171765955) has the molecular formula C31H44ClNO12 and a molecular weight of 658.14 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 171765955 |
| Molecular Formula | C31H44ClNO12 |
| Molecular Weight | 658.14 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(OCCOCCOCCOCCOCCOCCOCCOc2cc(Cl)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C31H44ClNO12/c1-31(2,3)45-30(34)25-4-6-28(7-5-25)43-20-18-41-16-14-39-12-10-37-8-9-38-11-13-40-15-17-42-19-21-44-29-23-26(32)22-27(24-29)33(35)36/h4-7,22-24H,8-21H2,1-3H3 |
| InChIKey | SQFIHWUOTACVQZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 143.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|