C23H38ClN3O9 — CID 168818071
tert-butyl N-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 168818071) has the molecular formula C23H38ClN3O9 and a molecular weight of 536.02 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 168818071 |
| Molecular Formula | C23H38ClN3O9 |
| Molecular Weight | 536.02 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[2-[2-(3-chloro-5-nitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCNc1cc(Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H38ClN3O9/c1-23(2,3)36-22(28)26-5-7-32-9-11-34-13-15-35-14-12-33-10-8-31-6-4-25-20-16-19(24)17-21(18-20)27(29)30/h16-18,25H,4-15H2,1-3H3,(H,26,28) |
| InChIKey | XEUKFOCJBXOUIT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 139.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.02 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|