C21H27ClN2O8 — CID 163260573
tert-butyl N-[2-[2-[2-[(3-chloro-1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 163260573) has the molecular formula C21H27ClN2O8 and a molecular weight of 470.91 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[(3-chloro-1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[(3-chloro-1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 163260573 |
| Molecular Formula | C21H27ClN2O8 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[(3-chloro-1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNc1c(O)c2c(c(O)c1Cl)C(=O)C=CC2=O |
| InChI | InChI=1S/C21H27ClN2O8/c1-21(2,3)32-20(29)24-7-9-31-11-10-30-8-6-23-17-16(22)18(27)14-12(25)4-5-13(26)15(14)19(17)28/h4-5,23,27-28H,6-11H2,1-3H3,(H,24,29) |
| InChIKey | JBASCFISTXWKOM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|