C20H38ClNO6 — CID 171589315
tert-butyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 171589315) has the molecular formula C20H38ClNO6 and a molecular weight of 423.98 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 171589315 |
| Molecular Formula | C20H38ClNO6 |
| Molecular Weight | 423.98 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCCCCCCl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38ClNO6/c1-19(2,3)27-17(23)22(18(24)28-20(4,5)6)12-14-26-16-15-25-13-10-8-7-9-11-21/h7-16H2,1-6H3 |
| InChIKey | ARJNMKBRONLESM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|