About 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate
5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate (PubChem CID 23729656) has the molecular formula C20H37NO7
and a molecular weight of 403.52 g/mol. Its IUPAC name is 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate.
Molecular Properties
| Compound Name | 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate |
| PubChem CID | 23729656 |
| Molecular Formula | C20H37NO7 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCCCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO7/c1-18(2,3)26-15(22)21(16(23)27-19(4,5)6)13-11-10-12-14-25-17(24)28-20(7,8)9/h10-14H2,1-9H3 |
| InChIKey | XUFNYZRPGNRHDB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate?
The IUPAC name of 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate (CID 23729656) is 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate.
What is the SMILES notation for 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate?
The canonical SMILES for 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate is CC(C)(C)OC(=O)OCCCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate?
The InChIKey is XUFNYZRPGNRHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO7/c1-18(2,3)26-15(22)21(16(23)27-19(4,5)6)13-11-10-12-14-25-17(24)28-20(7,8)9/h10-14H2,1-9H3.
What are the key properties of 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate?
5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate has a molecular weight of 403.52 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl tert-butyl carbonate is sourced from PubChem (CID 23729656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).