C16H30BrNO4 — CID 10738534
tert-butyl N-(6-bromohexyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 10738534) has the molecular formula C16H30BrNO4 and a molecular weight of 380.32 g/mol. Its IUPAC name is tert-butyl N-(6-bromohexyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(6-bromohexyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 10738534 |
| Molecular Formula | C16H30BrNO4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl N-(6-bromohexyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30BrNO4/c1-15(2,3)21-13(19)18(12-10-8-7-9-11-17)14(20)22-16(4,5)6/h7-12H2,1-6H3 |
| InChIKey | UZKNABCIXKPQIV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|