C16H30BrN3O4 — CID 173328405
tert-butyl N-(5-bromopentyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 173328405) has the molecular formula C16H30BrN3O4 and a molecular weight of 408.34 g/mol. Its IUPAC name is tert-butyl N-(5-bromopentyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-(5-bromopentyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173328405 |
| Molecular Formula | C16H30BrN3O4 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | tert-butyl N-(5-bromopentyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CCCCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30BrN3O4/c1-15(2,3)23-13(21)19-12(18)20(11-9-7-8-10-17)14(22)24-16(4,5)6/h7-11H2,1-6H3,(H2,18,19,21) |
| InChIKey | BTMDHMPUAWSXJQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|