C18H28N4O4 — CID 139533782
tert-butyl N-(anilinomethyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 139533782) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-(anilinomethyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-(anilinomethyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 139533782 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | tert-butyl N-(anilinomethyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CNc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N4O4/c1-17(2,3)25-15(23)21-14(19)22(16(24)26-18(4,5)6)12-20-13-10-8-7-9-11-13/h7-11,20H,12H2,1-6H3,(H2,19,21,23) |
| InChIKey | HWEXAFHMKAJVAK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|