C32H47N5O6 — CID 172717774
tert-butyl N-[[2-(benzylamino)-5-[ethyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 172717774) has the molecular formula C32H47N5O6 and a molecular weight of 597.76 g/mol. Its IUPAC name is tert-butyl N-[[2-(benzylamino)-5-[ethyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[[2-(benzylamino)-5-[ethyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 172717774 |
| Molecular Formula | C32H47N5O6 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | tert-butyl N-[[2-(benzylamino)-5-[ethyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CC)c1ccc(NCc2ccccc2)c(CN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C32H47N5O6/c1-11-36(26(33)35-27(38)41-30(2,3)4)24-17-18-25(34-20-22-15-13-12-14-16-22)23(19-24)21-37(28(39)42-31(5,6)7)29(40)43-32(8,9)10/h12-19,34H,11,20-21H2,1-10H3,(H2,33,35,38) |
| InChIKey | GCDYFTSAIGWLPO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|